CAS 312965-07-4 appears in our catalog under these names: (1S,2S)-Fmoc-2-aminocyclohexane carboxylic acid, 95%, Fmoc-1,2-trans-ACHC-OH (1S,2S), Fmoc-(1S,2S)-2-aminocyclohexane carboxylic acid 95%, (1S,2S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)cyclohexanecarboxylic acid, 97%, 97%, Fmoc-(1S,2S)-2-aminocyclohexane carboxylic acid, 98%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 50mg, 500mg, 10g.
Trans-(1S,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 312965-07-4) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: trans-(1S,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: NZMNDTGOODAUNI-ICSRJNTNSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | trans-(1S,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | NZMNDTGOODAUNI-ICSRJNTNSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)