CAS 389057-34-5 appears in our catalog under these names: (1R,2R)-Fmoc-2-aminocyclohexane carboxylic acid, 97%, Fmoc-1,2-trans-ACHC-OH (1R,2R), Fmoc-(1R,2R)-2-aminocyclohexane carboxylic acid, Fmoc-(1R,2R-ACHC-OH 95%, (1R,2R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)cyclohexanecarboxylic acid, 97%, 97%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 50mg, 1000mg, 500mg, 25g, 5g.
Trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 389057-34-5) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: NZMNDTGOODAUNI-UYAOXDASSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | trans-(1R,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | NZMNDTGOODAUNI-UYAOXDASSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)