(1S,2S)-2-Aminocyclopentanecarboxylic acid hydrochloride, 97%
cas: 359849-58-4 — see every product listed under this CAS number, including other names
(1S,2S)-2-Aminocyclopentanecarboxylic acid hydrochloride, 97% (CAS 359849-58-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A239549-250mg |
| cas | 359849-58-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 598.44 Pln | |
| Ambeed | 1g | 1260.38 Pln | |
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 525.20 Pln | |
| Chemat | 1g | 1120.40 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 642.02 Pln | |
| BLDpharm | 1g | 1352.88 Pln | |
| Fluorochem | 100mg | 679.99 Pln | |
| Fluorochem | 250mg | 961.14 Pln | |
| Fluorochem | 1g | 2075.33 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Trans-(1S,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride (CAS 359849-58-4) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: trans-(1S,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride. InChIKey: LVBDVNLIEHCCTP-FHAQVOQBSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | trans-(1S,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | LVBDVNLIEHCCTP-FHAQVOQBSA-N |
| SMILES | C1C[C@@H]([C@H](C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
(1S,2S)-2-aminocyclopentanecarboxylic Acid Hydrochloride, (1S,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride, (1S,2S)-(-)-2-Amino-1-cyclopentanecarboxylic acid hydrochloride, Cyclopentanecarboxylic acid, 2-amino-, hydrochloride, (1S,2S)-, (1S,2S)-2-aminocyclopentanecarboxylic acid;hydrochloride