cas: 222530-35-0 — see every product listed under this CAS number, including other names
(1S,3R)-Methyl 3-aminocyclohexanecarboxylate hydrochloride, 97% (CAS 222530-35-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg, 10g. Offered by: AmBeed, Chemat, BLDpharm.
| brand | AmBeed |
|---|---|
| catalog number | A1281428-5g |
| cas | 222530-35-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 18376.12 Pln | |
| Ambeed | 100mg | 987.81 Pln | |
| Ambeed | 250mg | 1288.19 Pln | |
| Ambeed | 1g | 3129.38 Pln | |
| Chemat | 100mg | 568.40 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 500mg | 1370.00 Pln | |
| Chemat | 1g | 1792.40 Pln | |
| Chemat | 5g | 8699.60 Pln | |
| Chemat | 10g | 15846.80 Pln | |
| BLDpharm | 100mg | 1058.54 Pln | |
| BLDpharm | 250mg | 1380.65 Pln | |
| BLDpharm | 1g | 3368.84 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Cis-methyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride (CAS 222530-35-0) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: cis-methyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: OOFXENVWECZJBF-UOERWJHTSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | cis-methyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | OOFXENVWECZJBF-UOERWJHTSA-N |
| SMILES | COC(=O)[C@H]1CCC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)