CAS 87360-22-3 appears in our catalog under these names: cis-Methyl 3-aminocyclohexanecarboxylate hydrochloride 98%, Methyl-cis-3-Aminocyclohexanecarboxylate hydrochloride, 97%, cis-Methyl 3-aminocyclohexanecarboxylate hydrochloride, 97%, 97%, H-1,3-cis-Achc-OMe hydrochloride, 98%, H-1,3-cis-ACHC-OMe*HCl. Offered by: Ambeed, Fluorochem, Chemat, Combi-blocks, Iris Biotech. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100mg, 500mg.
Cis-methyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride (CAS 87360-22-3) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: cis-methyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: OOFXENVWECZJBF-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | cis-methyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | OOFXENVWECZJBF-HHQFNNIRSA-N |
| SMILES | COC(=O)[C@@H]1CCC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)