CAS 222530-35-0 appears in our catalog under these names: (1S,3R)-Methyl 3-aminocyclohexanecarboxylate hydrochloride, 97%, (1S,3R)-Methyl 3-aminocyclohexanecarboxylate hydrochloride 97%, (1S,3R)-Methyl 3-aminocyclohexanecarboxylate hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g.
Cis-methyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride (CAS 222530-35-0) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: cis-methyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: OOFXENVWECZJBF-UOERWJHTSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | cis-methyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | OOFXENVWECZJBF-UOERWJHTSA-N |
| SMILES | COC(=O)[C@H]1CCC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)