CAS 712313-64-9 appears in our catalog under these names: Trans-methyl-3-aminocyclohexanecarboxylate hydrochloride, 95%, trans-Methyl 3-aminocyclohexanecarboxylate hydrochloride, 98%, Methyl trans-3-aminocyclohexanecarboxylate hydrochloride, 95. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 5g, 1g.
Trans-methyl (1R,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride (CAS 712313-64-9) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: trans-methyl (1R,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: OOFXENVWECZJBF-ZJLYAJKPSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | trans-methyl (1R,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | OOFXENVWECZJBF-ZJLYAJKPSA-N |
| SMILES | COC(=O)[C@@H]1CCC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)