CAS 1415825-01-2 is the registry number for (1R,3S)-Methyl 3-aminocyclohexanecarboxylate hydrochloride, 96%, 96%. Offered by: Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g.
Cis-methyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride (CAS 1415825-01-2) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: cis-methyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: OOFXENVWECZJBF-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | cis-methyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | OOFXENVWECZJBF-HHQFNNIRSA-N |
| SMILES | COC(=O)[C@@H]1CCC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)