cas: 2382403-64-5 — see every product listed under this CAS number, including other names
(1S,3S,4S)-2-tert-butoxycarbonyl-5-oxo-2-azabicyclo[2.2.2]octane-3-carboxylic acid, 97% (CAS 2382403-64-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F874754-100MG |
| cas | 2382403-64-5 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2663.66 Pln | |
| Fluorochem | 250mg | 4418.25 Pln | |
| Fluorochem | 500mg | 6454.00 Pln | |
| Fluorochem | 1g | 8619.90 Pln | |
| Fluorochem | 5g | 24499.72 Pln | |
| Chemat | 100mg | 1586.00 Pln | |
| Chemat | 250mg | 2651.60 Pln | |
| Chemat | 500mg | 3942.80 Pln | |
| Chemat | 1g | 5262.80 Pln | |
| Chemat | 5g | 14915.60 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(1S,3S,4S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-2-azabicyclo[2.2.2]octane-3-carboxylic acid (CAS 2382403-64-5) is a chemical compound with the molecular formula C13H19NO5 and a molecular weight of 269.29 g/mol. IUPAC name: (1S,3S,4S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-2-azabicyclo[2.2.2]octane-3-carboxylic acid. InChIKey: XMWGGNBDLXJXJZ-XKSSXDPKSA-N.
| Molecular formula | C13H19NO5 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | (1S,3S,4S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-2-azabicyclo[2.2.2]octane-3-carboxylic acid |
| InChIKey | XMWGGNBDLXJXJZ-XKSSXDPKSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]([C@H]1C(=O)O)C(=O)C2 |
Computed by PubChem (NCBI)