Products 2375262-52-3
CAS 2375262-52-3 appears in our catalog under these names: 3-(Dimethylamino)-1-phenylpropan-1-ol oxalate, 95%, 3-(Dimethylamino)-1-phenylpropan-1-ol oxalic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-(dimethylamino)-1-phenylpropan-1-ol;oxalic acid (CAS 2375262-52-3) is a chemical compound with the molecular formula C13H19NO5 and a molecular weight of 269.29 g/mol. IUPAC name: 3-(dimethylamino)-1-phenylpropan-1-ol;oxalic acid. InChIKey: WJDOYDOLXKWIKQ-UHFFFAOYSA-N.
| Molecular formula | C13H19NO5 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 3-(dimethylamino)-1-phenylpropan-1-ol;oxalic acid |
| InChIKey | WJDOYDOLXKWIKQ-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(C1=CC=CC=C1)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(dimethylamino)-1-phenylpropan-1-ol; oxalic acid, (S)-3-(Dimethylamino)-1-phenylpropan-1-ol oxalate, 3-(Dimethylamino)-1-phenylpropan-1-ol oxalic acid, 3-(Dimethylamino)-1-phenylpropan-1-ol;oxalic acid, 3-(dimethylamino)-1-phenylpropan-1-ol,oxalicacid, 3-(Dimethylamino)-1-phenylpropan-1-ol oxalate