CAS 270596-33-3 appears in our catalog under these names: Boc-(r)-3-amino-4-(2-furyl)-butyric acid, 95%, (R)-3-((tert-Butoxycarbonyl)amino)-4-(furan-2-yl)butanoic acid, 95+%, (R)–3–((tert–butoxycarbonyl)amino)–4–(furan–2–yl)butanoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
(3R)-4-(furan-2-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 270596-33-3) is a chemical compound with the molecular formula C13H19NO5 and a molecular weight of 269.29 g/mol. IUPAC name: (3R)-4-(furan-2-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: WFTLLVUGUYBNDJ-SECBINFHSA-N.
| Molecular formula | C13H19NO5 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | (3R)-4-(furan-2-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | WFTLLVUGUYBNDJ-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CO1)CC(=O)O |
Computed by PubChem (NCBI)