CAS 810677-16-8 appears in our catalog under these names: Mal-peg1-t-butyl ester, 95%, Mal-PEG1-Boc, Mal–PEG1–Boc, 1,1-Dimethylethyl 3-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy]propanoate, 98%, 98%, Mal-PEG1-Boc, 99.89%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 5mg, 50mg, 50 mg, 25 mg, 100 mg.
Tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate (CAS 810677-16-8) is a chemical compound with the molecular formula C13H19NO5 and a molecular weight of 269.29 g/mol. IUPAC name: tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate. InChIKey: YFNQRZMVQPRONS-UHFFFAOYSA-N.
| Molecular formula | C13H19NO5 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | tert-butyl 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate |
| InChIKey | YFNQRZMVQPRONS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)