CAS 2102412-64-4 appears in our catalog under these names: 5–tert–Butyl 6–methyl (6S)–4–oxo–5–azaspiro(2·4)heptane–5,6–dicarboxylate, 5-tert-Butyl 6-methyl (6s)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate, 95%, 5-(tert-Butyl) 6-methyl (S)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate, 97%, 97%, 5-tert-butyl 6-methyl (6S)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate, 98%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 500mg, 10g, 25g, 100mg, 250mg.
5-O-tert-butyl 6-O-methyl (6S)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate (CAS 2102412-64-4) is a chemical compound with the molecular formula C13H19NO5 and a molecular weight of 269.29 g/mol. IUPAC name: 5-O-tert-butyl 6-O-methyl (6S)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate. InChIKey: UONWHDJTCBUKSC-QMMMGPOBSA-N.
| Molecular formula | C13H19NO5 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 5-O-tert-butyl 6-O-methyl (6S)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate |
| InChIKey | UONWHDJTCBUKSC-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CC2(C1=O)CC2)C(=O)OC |
Computed by PubChem (NCBI)