CAS 935761-02-7 appears in our catalog under these names: 7-tert-Butyl 1-methyl 3-oxo-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate, 95%, 7-tert-Butyl 1-methyl 3-oxo-7-azabicyclo(2.2.1)heptane-1,7-dicarboxylate, 98%, 7-tert-Butyl 1-methyl 3-oxo-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
7-O-tert-butyl 1-O-methyl 3-oxo-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate (CAS 935761-02-7) is a chemical compound with the molecular formula C13H19NO5 and a molecular weight of 269.29 g/mol. IUPAC name: 7-O-tert-butyl 1-O-methyl 3-oxo-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate. InChIKey: SMOUCGHFXUTNGG-UHFFFAOYSA-N.
| Molecular formula | C13H19NO5 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 7-O-tert-butyl 1-O-methyl 3-oxo-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate |
| InChIKey | SMOUCGHFXUTNGG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1(CC2=O)C(=O)OC |
Computed by PubChem (NCBI)