cas: 135132-35-3 — see every product listed under this CAS number, including other names
(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)methanamine 95% (CAS 135132-35-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A437338-100mg |
| cas | 135132-35-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1655.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A437338 |
(2,2-difluoro-1,3-benzodioxol-5-yl)methanamine (CAS 135132-35-3) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)methanamine. InChIKey: GPHZBJCHTHXDDI-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)methanamine |
| InChIKey | GPHZBJCHTHXDDI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CN)OC(O2)(F)F |
Computed by PubChem (NCBI)