CAS 886497-08-1 appears in our catalog under these names: Methyl 4-amino-2,3-difluorobenzoate, 95%, Methyl 4-Amino-2,3-difluorobenzoate 97%, METHYL 4-AMINO-2,3-DIFLUOROBENZOATE, 97%, 97%, Methyl 4-amino-2,3-difluorobenzoate. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
Methyl 4-amino-2,3-difluorobenzoate (CAS 886497-08-1) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 4-amino-2,3-difluorobenzoate. InChIKey: MMVSLKNBOJAPEC-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 4-amino-2,3-difluorobenzoate |
| InChIKey | MMVSLKNBOJAPEC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)N)F)F |
Computed by PubChem (NCBI)