Products 225641-94-1
CAS 225641-94-1 appears in our catalog under these names: 3,4-Difluorophenylglycine, 95%, 2-((3,4-Difluorophenyl)amino)acetic acid, 95+%, 2-((3,4-Difluorophenyl)amino)acetic acid, 97%, 97%, 3,4-Difluorophenylglycine, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
2-amino-2-(3,4-difluorophenyl)acetic acid (CAS 225641-94-1) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 2-amino-2-(3,4-difluorophenyl)acetic acid. InChIKey: MPMRMNOQJFWMMA-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 2-amino-2-(3,4-difluorophenyl)acetic acid |
| InChIKey | MPMRMNOQJFWMMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)N)F)F |
Computed by PubChem (NCBI)
Synonyms:
3,4-Difluorophenylglycine, 2-amino-2-(3,4-difluorophenyl)acetic Acid, 3,4-Difluoro-DL-phenylglycine, amino(3,4-difluorophenyl)acetic acid, 2-((3,4-Difluorophenyl)amino)acetic acid, 2-(3,4-Difluorophenyl)glycine, dl-3,4-difluorophenylglycine, amino-(3,4-difluoro-phenyl)-acetic acid, 3,4-Difluoro-DL-phenylglycine (H-DL-Phg(3,4-diF)-OH)