CAS 886498-26-6 appears in our catalog under these names: 2,6-Difluoro-3-methoxybenzamide, 95%, 2,6–DIFLUORO–3–METHOXYBENZAMIDE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 10g, 10mg, 5mg.
2,6-difluoro-3-methoxybenzamide (CAS 886498-26-6) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 2,6-difluoro-3-methoxybenzamide. InChIKey: JWQAQJXFEPQZIV-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 2,6-difluoro-3-methoxybenzamide |
| InChIKey | JWQAQJXFEPQZIV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)C(=O)N)F |
Computed by PubChem (NCBI)