CAS 544440-09-7 appears in our catalog under these names: (2,4-Difluoro-phenyl)-carbamic acid methyl ester, 95%, (2,4-Difluoro-phenyl)-carbamic acid methyl ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
Methyl N-(2,4-difluorophenyl)carbamate (CAS 544440-09-7) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl N-(2,4-difluorophenyl)carbamate. InChIKey: DREYKINMQVKMMQ-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl N-(2,4-difluorophenyl)carbamate |
| InChIKey | DREYKINMQVKMMQ-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)