CAS 1211529-86-0 appears in our catalog under these names: 6-(1,1-Difluoroethyl)pyridine-2-carboxylic acid, 95%, 6-(1,1-Difluoroethyl)pyridine-2-carboxylic Acid, 6-(1,1-Difluoroethyl)picolinic acid, 95%, 95%, 6-(1,1-Difluoroethyl)picolinic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
6-(1,1-difluoroethyl)pyridine-2-carboxylic acid (CAS 1211529-86-0) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid. InChIKey: RSIRTUDFDFJYAW-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid |
| InChIKey | RSIRTUDFDFJYAW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC(=N1)C(=O)O)(F)F |
Computed by PubChem (NCBI)