cas: 1252793-57-9 — see every product listed under this CAS number, including other names
(2,3-DIHYDRO-1H-INDEN-4-YL)BORONIC ACID PINACOL ESTER, 98% (CAS 1252793-57-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F506374-250MG |
| cas | 1252793-57-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1736.91 Pln | |
| Fluorochem | 25g | 6375.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(2,3-dihydro-1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1252793-57-9) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 2-(2,3-dihydro-1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DYTLGZWBDATBAZ-UHFFFAOYSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 2-(2,3-dihydro-1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DYTLGZWBDATBAZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3CCCC3=CC=C2 |
Computed by PubChem (NCBI)