cas: 1252793-57-9 — see every product listed under this CAS number, including other names
2-(2,3-Dihydro-1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 1252793-57-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AA8Z-100mg |
| cas | 1252793-57-9 |
| size | 100mg |
| availability | 60g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 1538.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2,3-dihydro-1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1252793-57-9) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 2-(2,3-dihydro-1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DYTLGZWBDATBAZ-UHFFFAOYSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 2-(2,3-dihydro-1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DYTLGZWBDATBAZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3CCCC3=CC=C2 |
Computed by PubChem (NCBI)