cas: 2044-88-4 — see every product listed under this CAS number, including other names
(2,4-Dinitro-phenyl)-methyl-amine, 97% (CAS 2044-88-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F042153-250MG |
| cas | 2044-88-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 627.92 Pln | |
| Fluorochem | 1g | 1315.18 Pln | |
| Fluorochem | 5g | 3736.20 Pln | |
| Fluorochem | 25g | 14857.29 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-methyl-2,4-dinitroaniline (CAS 2044-88-4) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: N-methyl-2,4-dinitroaniline. InChIKey: IQEJEZOCXWJNKR-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | N-methyl-2,4-dinitroaniline |
| InChIKey | IQEJEZOCXWJNKR-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)