cas: 2044-88-4 — see every product listed under this CAS number, including other names
N-Methyl-2,4-dinitroaniline, ≥97%, ≥97% (CAS 2044-88-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1130HC-50mg |
| cas | 2044-88-4 |
| size | 50mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 218.00 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 789.20 Pln | |
| Chemat | 5g | 2195.60 Pln | |
| Chemat | 25g | 7941.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
N-methyl-2,4-dinitroaniline (CAS 2044-88-4) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: N-methyl-2,4-dinitroaniline. InChIKey: IQEJEZOCXWJNKR-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | N-methyl-2,4-dinitroaniline |
| InChIKey | IQEJEZOCXWJNKR-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)