cas: 4540-87-8 — see every product listed under this CAS number, including other names
(2-(((Benzyloxy)carbonyl)amino)ethyl)boronic acid, 95%, 95% (CAS 4540-87-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DC63-250mg |
| cas | 4540-87-8 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 1787.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(phenylmethoxycarbonylamino)ethylboronic acid (CAS 4540-87-8) is a chemical compound with the molecular formula C10H14BNO4 and a molecular weight of 223.04 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)ethylboronic acid. InChIKey: KHMDIKNZIMHPTI-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO4 |
|---|---|
| Molecular weight | 223.04 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylamino)ethylboronic acid |
| InChIKey | KHMDIKNZIMHPTI-UHFFFAOYSA-N |
| SMILES | B(CCNC(=O)OCC1=CC=CC=C1)(O)O |
Computed by PubChem (NCBI)