CAS 2225181-32-6 is the registry number for (2–(METHOXYCARBONYL)–6–(ISO–PROPYL)PYRIDIN–4–YL)BORONIC ACID. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(2-methoxycarbonyl-6-propan-2-yl-4-pyridinyl)boronic acid (CAS 2225181-32-6) is a chemical compound with the molecular formula C10H14BNO4 and a molecular weight of 223.04 g/mol. IUPAC name: (2-methoxycarbonyl-6-propan-2-yl-4-pyridinyl)boronic acid. InChIKey: HFBRZAKIALGVDU-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO4 |
|---|---|
| Molecular weight | 223.04 g/mol |
| IUPAC name | (2-methoxycarbonyl-6-propan-2-yl-4-pyridinyl)boronic acid |
| InChIKey | HFBRZAKIALGVDU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)C(=O)OC)C(C)C)(O)O |
Computed by PubChem (NCBI)