cas: 1563-56-0 — see every product listed under this CAS number, including other names
(2-Amino-5-bromophenyl)(pyridin-2-yl)methanone, 99.80% (CAS 1563-56-0) is a chemical reagent available from Chemat. Available pack sizes: 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W007077-5 g |
| cas | 1563-56-0 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.80% |
(2-amino-5-bromophenyl)-pyridin-2-ylmethanone (CAS 1563-56-0) is a chemical compound with the molecular formula C12H9BrN2O and a molecular weight of 277.12 g/mol. IUPAC name: (2-amino-5-bromophenyl)-pyridin-2-ylmethanone. InChIKey: KHVZPFKJBLTYCC-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O |
|---|---|
| Molecular weight | 277.12 g/mol |
| IUPAC name | (2-amino-5-bromophenyl)-pyridin-2-ylmethanone |
| InChIKey | KHVZPFKJBLTYCC-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)C2=C(C=CC(=C2)Br)N |
Computed by PubChem (NCBI)