cas: 1563-56-0 — see every product listed under this CAS number, including other names
2-(2-Amino-5-bromobenzoyl)pyridine 98% (CAS 1563-56-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217026-1g |
| cas | 1563-56-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 342.56 Pln | |
| Ambeed | 100g | 1076.81 Pln | |
| Ambeed | 500g | 3941.50 Pln | |
| Ambeed | 1000g | 6266.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A217026 |
(2-amino-5-bromophenyl)-pyridin-2-ylmethanone (CAS 1563-56-0) is a chemical compound with the molecular formula C12H9BrN2O and a molecular weight of 277.12 g/mol. IUPAC name: (2-amino-5-bromophenyl)-pyridin-2-ylmethanone. InChIKey: KHVZPFKJBLTYCC-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O |
|---|---|
| Molecular weight | 277.12 g/mol |
| IUPAC name | (2-amino-5-bromophenyl)-pyridin-2-ylmethanone |
| InChIKey | KHVZPFKJBLTYCC-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)C2=C(C=CC(=C2)Br)N |
Computed by PubChem (NCBI)