cas: 1563-56-0 — see every product listed under this CAS number, including other names
2-(2-Amino-5-bromobenzoyl)pyridine, 97% (CAS 1563-56-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216395-1G |
| cas | 1563-56-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 320.74 Pln | |
| Fluorochem | 100g | 1044.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2-amino-5-bromophenyl)-pyridin-2-ylmethanone (CAS 1563-56-0) is a chemical compound with the molecular formula C12H9BrN2O and a molecular weight of 277.12 g/mol. IUPAC name: (2-amino-5-bromophenyl)-pyridin-2-ylmethanone. InChIKey: KHVZPFKJBLTYCC-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O |
|---|---|
| Molecular weight | 277.12 g/mol |
| IUPAC name | (2-amino-5-bromophenyl)-pyridin-2-ylmethanone |
| InChIKey | KHVZPFKJBLTYCC-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)C2=C(C=CC(=C2)Br)N |
Computed by PubChem (NCBI)