cas: 1563-56-0 — see every product listed under this CAS number, including other names
2-(2-amino-5-bromobenzoyl)pyridine, 98%, 98% (CAS 1563-56-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112OO5-250mg |
| cas | 1563-56-0 |
| size | 250mg |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 237.20 Pln | |
| Chemat | 100g | 707.60 Pln | |
| Chemat | 500g | 3014.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-amino-5-bromophenyl)-pyridin-2-ylmethanone (CAS 1563-56-0) is a chemical compound with the molecular formula C12H9BrN2O and a molecular weight of 277.12 g/mol. IUPAC name: (2-amino-5-bromophenyl)-pyridin-2-ylmethanone. InChIKey: KHVZPFKJBLTYCC-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O |
|---|---|
| Molecular weight | 277.12 g/mol |
| IUPAC name | (2-amino-5-bromophenyl)-pyridin-2-ylmethanone |
| InChIKey | KHVZPFKJBLTYCC-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)C2=C(C=CC(=C2)Br)N |
Computed by PubChem (NCBI)