Products 2828439-67-2
CAS 2828439-67-2 is the registry number for (3-Bromo-4,5-dimethylphenyl)boronic acid, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(3-bromo-4,5-dimethylphenyl)boronic acid (CAS 2828439-67-2) is a chemical compound with the molecular formula C8H10BBrO2 and a molecular weight of 228.88 g/mol. IUPAC name: (3-bromo-4,5-dimethylphenyl)boronic acid. InChIKey: FVIYPLSTMCCQGL-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO2 |
|---|---|
| Molecular weight | 228.88 g/mol |
| IUPAC name | (3-bromo-4,5-dimethylphenyl)boronic acid |
| InChIKey | FVIYPLSTMCCQGL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Br)C)C)(O)O |
Computed by PubChem (NCBI)