CAS 1259318-83-6 appears in our catalog under these names: (3-Bromo-2,5-dimethylphenyl)boronic acid, 97%, 3-Bromo-2,5-dimethylphenylboronic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(3-bromo-2,5-dimethylphenyl)boronic acid (CAS 1259318-83-6) is a chemical compound with the molecular formula C8H10BBrO2 and a molecular weight of 228.88 g/mol. IUPAC name: (3-bromo-2,5-dimethylphenyl)boronic acid. InChIKey: URNNEMQNWANJJC-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO2 |
|---|---|
| Molecular weight | 228.88 g/mol |
| IUPAC name | (3-bromo-2,5-dimethylphenyl)boronic acid |
| InChIKey | URNNEMQNWANJJC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1C)Br)C)(O)O |
Computed by PubChem (NCBI)