cas: 1001109-50-7 — see every product listed under this CAS number, including other names
(2-Bromo-4-(trifluoromethyl)phenyl)methanamine 95% (CAS 1001109-50-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A371840-100mg |
| cas | 1001109-50-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 531.69 Pln | |
| Ambeed | 5g | 2150.38 Pln | |
| Ambeed | 10g | 3707.88 Pln | |
| Ambeed | 25g | 7351.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A371840 |
[2-bromo-4-(trifluoromethyl)phenyl]methanamine (CAS 1001109-50-7) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: [2-bromo-4-(trifluoromethyl)phenyl]methanamine. InChIKey: DMFTZOQOLDWTPA-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | [2-bromo-4-(trifluoromethyl)phenyl]methanamine |
| InChIKey | DMFTZOQOLDWTPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)CN |
Computed by PubChem (NCBI)