CAS 843608-46-8 appears in our catalog under these names: 1-(4-Bromo-phenyl)-2,2,2-trifluoro-ethylamine, 98%, 1–(4–BROMO–PHENYL)–2,2,2–TRIFLUORO–ETHYLAMINE, 1-(4-Bromophenyl)-2,2,2-trifluoroethanamine, (R)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine, 97%, 97%, 1-(4-Bromophenyl)-2,2,2-trifluoroethanamine, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 50mg, 2,5g, 100mg.
1-(4-bromophenyl)-2,2,2-trifluoroethanamine (CAS 843608-46-8) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZUFCCCNTJRQNCF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZUFCCCNTJRQNCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)Br |
Computed by PubChem (NCBI)