CAS 691877-04-0 appears in our catalog under these names: 3-Bromo-5-(trifluoromethyl)benzylamine, 95%, (3-Bromo-5-(trifluoromethyl)phenyl)methanamine, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
[3-bromo-5-(trifluoromethyl)phenyl]methanamine (CAS 691877-04-0) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: [3-bromo-5-(trifluoromethyl)phenyl]methanamine. InChIKey: DYFSALRUMZSKBU-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | [3-bromo-5-(trifluoromethyl)phenyl]methanamine |
| InChIKey | DYFSALRUMZSKBU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)Br)CN |
Computed by PubChem (NCBI)