CAS 50885-29-5 appears in our catalog under these names: 4-Bromo-n-(2,2,2-trifluoroethyl)aniline, 95%, 4-bromo-N-(2,2,2-trifluoroethyl)aniline, 4-Bromo-n-(2,2,2-trifluoroethyl)aniline, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 5g, 100mg.
4-bromo-N-(2,2,2-trifluoroethyl)aniline (CAS 50885-29-5) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: 4-bromo-N-(2,2,2-trifluoroethyl)aniline. InChIKey: JHMCLUDNRSGKDA-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | 4-bromo-N-(2,2,2-trifluoroethyl)aniline |
| InChIKey | JHMCLUDNRSGKDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NCC(F)(F)F)Br |
Computed by PubChem (NCBI)