Products 843608-54-8
CAS 843608-54-8 appears in our catalog under these names: (1R)-1-(3-Bromophenyl)-2,2,2-trifluoroethylamine, 95%, (R)-1-(3-Bromophenyl)-2,2,2-trifluoroethanamine, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(1R)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine (CAS 843608-54-8) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: (1R)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine. InChIKey: WBOABZOPYZNWCX-SSDOTTSWSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | (1R)-1-(3-bromophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | WBOABZOPYZNWCX-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@H](C(F)(F)F)N |
Computed by PubChem (NCBI)