CAS 778565-93-8 appears in our catalog under these names: (S)-1-(4-Bromo-phenyl)-2,2,2-trifluoro-ethylamine, 95%, (S)–1–(4–Bromophenyl)–2,2,2–trifluoroethanamine, (S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine 97%, (S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine, 97%, 97%, (S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine (CAS 778565-93-8) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZUFCCCNTJRQNCF-ZETCQYMHSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZUFCCCNTJRQNCF-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)N)Br |
Computed by PubChem (NCBI)