cas: 1451393-45-5 — see every product listed under this CAS number, including other names
(2-Bromo-4-chlorophenyl)boronic acid, 98%, 98% (CAS 1451393-45-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 50g, 75g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DM0A-100mg |
| cas | 1451393-45-5 |
| size | 100mg |
| availability | 150g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 25g | 1048.40 Pln | |
| Chemat | 50g | 1936.40 Pln | |
| Chemat | 75g | 2848.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-bromo-4-chlorophenyl)boronic acid (CAS 1451393-45-5) is a chemical compound with the molecular formula C6H5BBrClO2 and a molecular weight of 235.27 g/mol. IUPAC name: (2-bromo-4-chlorophenyl)boronic acid. InChIKey: GMMUCVGZXGOUNM-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrClO2 |
|---|---|
| Molecular weight | 235.27 g/mol |
| IUPAC name | (2-bromo-4-chlorophenyl)boronic acid |
| InChIKey | GMMUCVGZXGOUNM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)Br)(O)O |
Computed by PubChem (NCBI)