cas: 1451393-45-5 — see every product listed under this CAS number, including other names
2-BROMO-4-CHLOROPHENYLBORONIC ACID, 98% (CAS 1451393-45-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F529910-25G |
| cas | 1451393-45-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 2090.95 Pln | |
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 466.52 Pln | |
| Fluorochem | 10g | 872.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2-bromo-4-chlorophenyl)boronic acid (CAS 1451393-45-5) is a chemical compound with the molecular formula C6H5BBrClO2 and a molecular weight of 235.27 g/mol. IUPAC name: (2-bromo-4-chlorophenyl)boronic acid. InChIKey: GMMUCVGZXGOUNM-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrClO2 |
|---|---|
| Molecular weight | 235.27 g/mol |
| IUPAC name | (2-bromo-4-chlorophenyl)boronic acid |
| InChIKey | GMMUCVGZXGOUNM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)Br)(O)O |
Computed by PubChem (NCBI)