(2-Butoxy-5-fluorophenyl)boronic acid, 98%
cas: 480438-62-8 — see every product listed under this CAS number, including other names
(2-Butoxy-5-fluorophenyl)boronic acid, 98% (CAS 480438-62-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F219651-1G |
| cas | 480438-62-8 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 362.39 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 637.38 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 405.20 Pln | |
| BLDpharm | 100mg | 153.30 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 680.90 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2-butoxy-5-fluorophenyl)boronic acid (CAS 480438-62-8) is a chemical compound with the molecular formula C10H14BFO3 and a molecular weight of 212.03 g/mol. IUPAC name: (2-butoxy-5-fluorophenyl)boronic acid. InChIKey: ILEICROJFBXMNF-UHFFFAOYSA-N.
| Molecular formula | C10H14BFO3 |
|---|---|
| Molecular weight | 212.03 g/mol |
| IUPAC name | (2-butoxy-5-fluorophenyl)boronic acid |
| InChIKey | ILEICROJFBXMNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)OCCCC)(O)O |
Computed by PubChem (NCBI)