CAS 1333392-80-5 appears in our catalog under these names: 5-fluoro-2-(isopropoxymethyl)phenylboronic acid, 95%, (5–fluoro–2–(isopropoxymethyl)phenyl)boronic acid, Boronic acid, B-[5-fluoro-2-[(1-methylethoxy)methyl]phenyl]-, 98%, 98%, (5-Fluoro-2-(isopropoxymethyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
[5-fluoro-2-(propan-2-yloxymethyl)phenyl]boronic acid (CAS 1333392-80-5) is a chemical compound with the molecular formula C10H14BFO3 and a molecular weight of 212.03 g/mol. IUPAC name: [5-fluoro-2-(propan-2-yloxymethyl)phenyl]boronic acid. InChIKey: NMKVOYZVOGHDAI-UHFFFAOYSA-N.
| Molecular formula | C10H14BFO3 |
|---|---|
| Molecular weight | 212.03 g/mol |
| IUPAC name | [5-fluoro-2-(propan-2-yloxymethyl)phenyl]boronic acid |
| InChIKey | NMKVOYZVOGHDAI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)COC(C)C)(O)O |
Computed by PubChem (NCBI)