Products 1217500-65-6
CAS 1217500-65-6 appears in our catalog under these names: 2-Fluoro-5-isobutoxyphenylboronic acid, 98%, (2-Fluoro-5-isobutoxyphenyl)boronic acid, 98%, (2-Fluoro-5-isobutoxyphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 25g.
[2-fluoro-5-(2-methylpropoxy)phenyl]boronic acid (CAS 1217500-65-6) is a chemical compound with the molecular formula C10H14BFO3 and a molecular weight of 212.03 g/mol. IUPAC name: [2-fluoro-5-(2-methylpropoxy)phenyl]boronic acid. InChIKey: OYEDQMGDFFCTRX-UHFFFAOYSA-N.
| Molecular formula | C10H14BFO3 |
|---|---|
| Molecular weight | 212.03 g/mol |
| IUPAC name | [2-fluoro-5-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | OYEDQMGDFFCTRX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OCC(C)C)F)(O)O |
Computed by PubChem (NCBI)