Products 1217500-66-7
CAS 1217500-66-7 appears in our catalog under these names: 2-Fluoro-3-isobutoxyphenylboronic acid, 95%, (2-Fluoro-3-isobutoxyphenyl)boronic acid 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
[2-fluoro-3-(2-methylpropoxy)phenyl]boronic acid (CAS 1217500-66-7) is a chemical compound with the molecular formula C10H14BFO3 and a molecular weight of 212.03 g/mol. IUPAC name: [2-fluoro-3-(2-methylpropoxy)phenyl]boronic acid. InChIKey: BWKSJTLWBHWGNM-UHFFFAOYSA-N.
| Molecular formula | C10H14BFO3 |
|---|---|
| Molecular weight | 212.03 g/mol |
| IUPAC name | [2-fluoro-3-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | BWKSJTLWBHWGNM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OCC(C)C)F)(O)O |
Computed by PubChem (NCBI)