Products 850592-98-2
CAS 850592-98-2 appears in our catalog under these names: 3-Fluoro-5-(tert-butoxy)phenylboronic acid, 95%, 3-Fluoro-5-(tert-butoxy)phenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
[3-fluoro-5-[(2-methylpropan-2-yl)oxy]phenyl]boronic acid (CAS 850592-98-2) is a chemical compound with the molecular formula C10H14BFO3 and a molecular weight of 212.03 g/mol. IUPAC name: [3-fluoro-5-[(2-methylpropan-2-yl)oxy]phenyl]boronic acid. InChIKey: YHQSOXYGCDAKLM-UHFFFAOYSA-N.
| Molecular formula | C10H14BFO3 |
|---|---|
| Molecular weight | 212.03 g/mol |
| IUPAC name | [3-fluoro-5-[(2-methylpropan-2-yl)oxy]phenyl]boronic acid |
| InChIKey | YHQSOXYGCDAKLM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Fluoro-5-(tert-butoxy)phenylboronic acid, (3-(tert-Butoxy)-5-fluorophenyl)boronic acid, 3-Fluoro-5-(t-butoxy)phenylboronic acid, 3-Tert-butoxy-5-fluorophenylboronic acid, YHQSOXYGCDAKLM-UHFFFAOYSA-N, (3-tert-butoxy-5-fluoro-phenyl)boronic acid, [3-fluoro-5-[(2-methylpropan-2-yl)oxy]phenyl]boronic acid