Products 871125-94-9

CAS 871125-94-9 is the registry number for 3-Butoxy-2-fluorophenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(3-butoxy-2-fluorophenyl)boronic acid (CAS 871125-94-9) is a chemical compound with the molecular formula C10H14BFO3 and a molecular weight of 212.03 g/mol. IUPAC name: (3-butoxy-2-fluorophenyl)boronic acid. InChIKey: WNJLIXXAMYHSLC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14BFO3
Molecular weight212.03 g/mol
IUPAC name(3-butoxy-2-fluorophenyl)boronic acid
InChIKeyWNJLIXXAMYHSLC-UHFFFAOYSA-N
SMILESB(C1=C(C(=CC=C1)OCCCC)F)(O)O

Computed by PubChem (NCBI)