(2-Butoxy-5-chlorophenyl)boronic acid 98%
cas: 352534-88-4 — see every product listed under this CAS number, including other names
(2-Butoxy-5-chlorophenyl)boronic acid 98% (CAS 352534-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A558212-100mg |
| cas | 352534-88-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 470.50 Pln | |
| Ambeed | 5g | 1455.06 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A558212 |
(2-butoxy-5-chlorophenyl)boronic acid (CAS 352534-88-4) is a chemical compound with the molecular formula C10H14BClO3 and a molecular weight of 228.48 g/mol. IUPAC name: (2-butoxy-5-chlorophenyl)boronic acid. InChIKey: GGIBHUXEZCJVCZ-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO3 |
|---|---|
| Molecular weight | 228.48 g/mol |
| IUPAC name | (2-butoxy-5-chlorophenyl)boronic acid |
| InChIKey | GGIBHUXEZCJVCZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)OCCCC)(O)O |
Computed by PubChem (NCBI)