(2-Butoxy-5-chlorophenyl)boronic acid, 98%
cas: 352534-88-4 — see every product listed under this CAS number, including other names
(2-Butoxy-5-chlorophenyl)boronic acid, 98% (CAS 352534-88-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A558212-250mg |
| cas | 352534-88-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 414.88 Pln | |
| Ambeed | 5g | 1288.19 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 352.40 Pln | |
| BLDpharm | 100mg | 131.09 Pln | |
| BLDpharm | 250mg | 164.41 Pln | |
| BLDpharm | 1g | 331.02 Pln | |
| BLDpharm | 5g | 986.34 Pln | |
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 638.33 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2-butoxy-5-chlorophenyl)boronic acid (CAS 352534-88-4) is a chemical compound with the molecular formula C10H14BClO3 and a molecular weight of 228.48 g/mol. IUPAC name: (2-butoxy-5-chlorophenyl)boronic acid. InChIKey: GGIBHUXEZCJVCZ-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO3 |
|---|---|
| Molecular weight | 228.48 g/mol |
| IUPAC name | (2-butoxy-5-chlorophenyl)boronic acid |
| InChIKey | GGIBHUXEZCJVCZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)OCCCC)(O)O |
Computed by PubChem (NCBI)