CAS 603122-80-1 appears in our catalog under these names: Methyl 4–borono–3–chlorobenzoate(contains varying amounts of Anhydride), 2-Chloro-4-(methoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride), (2-Chloro-4-(methoxycarbonyl)phenyl)boronic acid, 97%, 97%, Methyl 4-borono-3-chlorobenzoate, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 50g, 250mg, 100g, 500g.
(2-chloro-4-methoxycarbonylphenyl)boronic acid (CAS 603122-80-1) is a chemical compound with the molecular formula C8H8BClO4 and a molecular weight of 214.41 g/mol. IUPAC name: (2-chloro-4-methoxycarbonylphenyl)boronic acid. InChIKey: ITEQHBSWRMYSRP-UHFFFAOYSA-N.
| Molecular formula | C8H8BClO4 |
|---|---|
| Molecular weight | 214.41 g/mol |
| IUPAC name | (2-chloro-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | ITEQHBSWRMYSRP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)Cl)(O)O |
Computed by PubChem (NCBI)