cas: 913835-30-0 — see every product listed under this CAS number, including other names
(2-Chloro-5-ethoxyphenyl)boronic acid, 97% (CAS 913835-30-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215956-1G |
| cas | 913835-30-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 10g | 1320.39 Pln | |
| Fluorochem | 25g | 3215.55 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2-chloro-5-ethoxyphenyl)boronic acid (CAS 913835-30-0) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (2-chloro-5-ethoxyphenyl)boronic acid. InChIKey: LIFPTULDIUUUBK-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (2-chloro-5-ethoxyphenyl)boronic acid |
| InChIKey | LIFPTULDIUUUBK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OCC)Cl)(O)O |
Computed by PubChem (NCBI)